[1-(phenoxymethyl)cyclopropyl]methanamine
Catalog No: FT-0715480
CAS No: 959240-02-9
- Chemical Name: [1-(phenoxymethyl)cyclopropyl]methanamine
- Molecular Formula: C11H15NO
- Molecular Weight: 177.24
- InChI Key: PQUPHTVFWGNPPG-UHFFFAOYSA-N
- InChI: InChI=1S/C11H15NO/c12-8-11(6-7-11)9-13-10-4-2-1-3-5-10/h1-5H,6-9,12H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 959240-02-9 |
|---|---|
| MF: | C11H15NO |
| Density: | 1.068g/cm3 |
| Flash_Point: | 119ºC |
| Melting_Point: | N/A |
| Product_Name: | [1-(phenoxymethyl)cyclopropyl]methanamine |
| Symbol: | GHS07 |
| Bolling_Point: | 274.2ºC at 760 mmHg |
| FW: | 177.24300 |
| Density: | 1.068g/cm3 |
|---|---|
| MF: | C11H15NO |
| LogP: | 2.50460 |
| Exact_Mass: | 177.11500 |
| Bolling_Point: | 274.2ºC at 760 mmHg |
| Flash_Point: | 119ºC |
| FW: | 177.24300 |
| Refractive_Index: | 1.55 |
| PSA: | 35.25000 |
| Safety_Statements: | H302-H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2922299090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)